A1345412
2-Bromo-5-fluorobenzonitrile , 98% , 57381-39-2
CAS NO.:57381-39-2
Empirical Formula: C7H3BrFN
Molecular Weight: 200.01
MDL number: MFCD00142875
EINECS: 260-711-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB372.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-95 °C(lit.) |
| Boiling point: | 251.2±25.0 °C(Predicted) |
| Density | 1.69±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| color | White to Yellow to Orange |
| BRN | 8678330 |
| InChI | InChI=1S/C7H3BrFN/c8-7-2-1-6(9)3-5(7)4-10/h1-3H |
| InChIKey | MDHNVHCZDCSTMS-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(F)=CC=C1Br |
| CAS DataBase Reference | 57381-39-2(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-fluorobenzonitrile may be used in the preparation of 5-chloro-4,2?-difluorobiphenyl-2-carbonitrile.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 26-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |





