A1345812
4-Bromo-2-methylbenzonitrile , 98% , 67832-11-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB26.40 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB141.60 | In Stock |
|
| 100G | RMB548.00 | In Stock |
|
| 500g | RMB2677.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-69 °C |
| Boiling point: | 228.5°C (rough estimate) |
| Density | 1.5466 (rough estimate) |
| refractive index | 1.6550 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| color | White to Light yellow |
| Water Solubility | insoluble |
| BRN | 2574103 |
| InChI | InChI=1S/C8H6BrN/c1-6-4-8(9)3-2-7(6)5-10/h2-4H,1H3 |
| InChIKey | LPEBMDFRIKYFCF-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(Br)C=C1C |
| CAS DataBase Reference | 67832-11-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Bromo-2-methylbenzonitrile(67832-11-5) |
Description and Uses
4-Bromo-2-methylbenzonitrile serves as a precursor for synthesizing 1,3,5-tris(4-bromo-2-methylphenyl)triazine under acid-catalyzed conditions with triflic acid[1]. The compound is reduced using borane–tetrahydrofuran complex to yield 4-bromo-2-methylbenzylamine[2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-22-37/39 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






