A1346512
(+)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane , 97% , 93379-49-8
Synonym(s):
(+)-trans-α,α′-(2,2-Dimethyl-1,3-dioxolane-4,5-diyl)bis(diphenylmethanol);(+)-2,3-O-Isopropylidene-1,1,4,4-tetraphenyl-D -threitol;(4S,5S)-4,5-Bis(diphenylhydroxymethyl)-2,2-dimethyldioxolane
| Pack Size | Price | Stock | Quantity |
| 1G | RMB114.40 | In Stock |
|
| 5G | RMB332.00 | In Stock |
|
| 25g | RMB1230.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-196 °C(lit.) |
| Boiling point: | 633.2±50.0 °C(Predicted) |
| alpha | -62.6 º (c=1 in chloroform) |
| Density | 1.200±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 12.28±0.29(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]19/D +67°, c = 1 in chloroform |
| BRN | 4724097 |
| InChIKey | RNSJHECWLNVNFE-LOYHVIPDSA-N |
| SMILES | C(O)(C1C=CC=CC=1)(C1C=CC=CC=1)[C@H]1OC(C)(C)O[C@@H]1C(O)(C1C=CC=CC=1)C1C=CC=CC=1 |&1:14,20,r| |
| CAS DataBase Reference | 93379-49-8(CAS DataBase Reference) |
Description and Uses
Ligand for enantioselective Lewis-acid mediated Diels-Alder, allyltitanation of aldehydes, and Michael-Mukaiyama additions promoted by chiral Ti-complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |

![(+)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane](https://img.chemicalbook.com/CAS/GIF/93379-49-8.gif)



