A1347012
3-Bromo-2-methylbenzoic Acid , 98% , 76006-33-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB90.40 | In Stock |
|
| 100g | RMB341.60 | In Stock |
|
| 500g | RMB1419.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152-156 °C (lit.) |
| Boiling point: | 316.1±30.0 °C(Predicted) |
| Density | 1.599±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform, methanol |
| form | Powder |
| pka | 3.56±0.10(Predicted) |
| color | White to orange or brown |
| Sensitive | Light Sensitive/Air Sensitive |
| InChI | InChI=1S/C8H7BrO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11) |
| InChIKey | BJGKVCKGUBYULR-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Br)=C1C |
| CAS DataBase Reference | 76006-33-2(CAS DataBase Reference) |
Description and Uses
3-Bromo-2-methylbenzoic acid may be used to synthesize 4-(bromoacetyl)isoindolin-1-one and isocoumarins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |






