A1347112
4-Bromo-3-methylbenzoic acid , 98% , 7697-28-1
CAS NO.:7697-28-1
Empirical Formula: C8H7BrO2
Molecular Weight: 215.04
MDL number: MFCD00039526
EINECS: 231-713-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100g | RMB368.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 212-216 °C(lit.) |
| Boiling point: | 311.4±30.0 °C(Predicted) |
| Density | 1.599±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| pka | 4.04±0.10(Predicted) |
| color | Yellow to orange to tan |
| BRN | 2356649 |
| InChI | InChI=1S/C8H7BrO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11) |
| InChIKey | KWVXDZLVCISXIB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C(C)=C1 |
| CAS DataBase Reference | 7697-28-1(CAS DataBase Reference) |
Description and Uses
4-Bromo-3-methylbenzoic acid serves as a precursor for synthesizing derivatives of 1-isopropyl-3-acyl-5-methyl-benzimidazol-one, which exhibit antifungal activity against B. cinerea [4]. The compound undergoes esterification when refluxed with methanol and concentrated sulfuric acid [5].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |




