A1347212
(R)-(-)-4-Benzyl-3-propionyl-2-oxazolidinone , 97% , 131685-53-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB230.40 | In Stock |
|
| 25G | RMB1080.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45 °C |
| Boiling point: | 396.6±11.0 °C(Predicted) |
| Density | 1.206±0.06 g/cm3(Predicted) |
| refractive index | -103 ° (C=1, EtOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Ethanol |
| pka | -2.35±0.40(Predicted) |
| form | Solid |
| color | Off-White |
| optical activity | [α]20/D 102°, c = 1 in ethanol |
| InChI | InChI=1S/C13H15NO3/c1-2-12(15)14-11(9-17-13(14)16)8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | WHOBYFHKONUTMW-LLVKDONJSA-N |
| SMILES | O1C[C@@H](CC2=CC=CC=C2)N(C(=O)CC)C1=O |
| CAS DataBase Reference | 131685-53-5(CAS DataBase Reference) |
Description and Uses
(R)-(-)-4-BENZYL-3-PROPIONYL-2-OXAZOLIDINONE is a oxazolidinone derivative used in the preparation of anisomycin analogues as activators of the JNK/SAPK1 and p38/SAPK2 pathways.
Safety
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |






