PRODUCT Properties
| Boiling point: | 89 °C/1 mmHg (lit.) |
| Density | 1.581 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 209 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.581 |
| BRN | 2358880 |
| InChI | InChI=1S/C7H6BrFO/c1-10-7-3-2-5(9)4-6(7)8/h2-4H,1H3 |
| InChIKey | JIQXVIJARQLCOY-UHFFFAOYSA-N |
| SMILES | C1(OC)=CC=C(F)C=C1Br |
| CAS DataBase Reference | 452-08-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromo-4-fluoroanisole(452-08-4) |
Description and Uses
2-Bromo-4-fluoroanisole was used in the synthesis of (5-fluoro-2-methoxyphenyl)methanol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29093090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





