A1349712
(1S,4R)-(-)-4-(Boc-amino)-2-cyclopentene-1-carboxylic acid , 98% , 151907-79-8
CAS NO.:151907-79-8
Empirical Formula: C11H17NO4
Molecular Weight: 227.26
MDL number: MFCD00211287
EINECS: 634-898-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB195.20 | In Stock |
|
| 1G | RMB491.20 | In Stock |
|
| 5g | RMB1719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152.9 °C |
| Boiling point: | 368.97°C (rough estimate) |
| Density | 1.1781 (rough estimate) |
| refractive index | 1.5718 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 4.31±0.40(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D -48,5±2°, c =1% in methanol |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C11H17NO4/c1-11(2,3)16-10(15)12-8-5-4-7(6-8)9(13)14/h4-5,7-8H,6H2,1-3H3,(H,12,15)(H,13,14)/t7-,8+/m1/s1 |
| InChIKey | WOUNTSATDZJBLP-SFYZADRCSA-N |
| SMILES | [C@H]1(C(O)=O)C[C@@H](NC(OC(C)(C)C)=O)C=C1 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| HazardClass | IRRITANT |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







