A1352712
Bis(2,4,6-trichlorophenyl) oxalate , Used for chemical lighting test, ≥99%(at) , 1165-91-9
Synonym(s):
2,4,6-Trichlorophenyl oxalate;Oxalic acid bis(2,4,6-trichlorophenyl) ester;TCPO
| Pack Size | Price | Stock | Quantity |
| 1G | RMB53.60 | In Stock |
|
| 5G | RMB157.60 | In Stock |
|
| 25G | RMB605.60 | In Stock |
|
| 100g | RMB2016.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-192 °C |
| Boiling point: | 556.17°C (rough estimate) |
| Density | 1.698 |
| refractive index | 1.5550 (estimate) |
| Flash point: | 188-192°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in hot Toluene |
| form | Crystalline Powder |
| color | White |
| BRN | 2312135 |
| InChI | InChI=1S/C14H4Cl6O4/c15-5-1-7(17)11(8(18)2-5)23-13(21)14(22)24-12-9(19)3-6(16)4-10(12)20/h1-4H |
| InChIKey | GEVPIWPYWJZSPR-UHFFFAOYSA-N |
| SMILES | C(OC1=C(Cl)C=C(Cl)C=C1Cl)(=O)C(OC1=C(Cl)C=C(Cl)C=C1Cl)=O |
| CAS DataBase Reference | 1165-91-9(CAS DataBase Reference) |
Description and Uses
Bis(2,4,6-trichlorophenyl)ethanedioate is a chemiluminescent chemical that is often used as a fluorescent dye. Bis(2,4,6-Trichlorophenyl)Oxalate is often used in chemiluminescent assays, in types of ELISA and for the detection of various particles, structure or compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 29171190 |
