A1353812
(R)-3-(Boc-amino)piperidine , 98% , 309956-78-3
Synonym(s):
(R)-3-tert-Butoxycarbonylaminopiperidine;tert-Butyl (R)-piperidin-3-ylcarbamate
CAS NO.:309956-78-3
Empirical Formula: C10H20N2O2
Molecular Weight: 200.28
MDL number: MFCD03093382
EINECS: 685-989-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB220.00 | In Stock |
|
| 100G | RMB720.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121.0 to 125.0 °C |
| Boiling point: | 304.8±31.0 °C(Predicted) |
| Density | 1.02±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol and ethanol. |
| pka | 12.37±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]22/D +3.2°, c = 0.5 in DMF |
| BRN | 10662518 |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-8-5-4-6-11-7-8/h8,11H,4-7H2,1-3H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | WUOQXNWMYLFAHT-MRVPVSSYSA-N |
| SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CCCNC1 |
| CAS DataBase Reference | 309956-78-3(CAS DataBase Reference) |
Description and Uses
(R)-3-(Boc-amino)piperidine is used as an organic chemical synthesis intermediate.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335-H400 |
| Precautionary statements | P273-P280-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xi,N |
| Risk Statements | 37/38-41-50 |
| Safety Statements | 26-39-61-29-36 |
| RIDADR | 3077 |
| WGK Germany | 2 |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






