A1353912
3-(Boc-amino)piperidine , 97% , 172603-05-3
CAS NO.：172603-05-3
Empirical Formula: C10H20N2O2
Molecular Weight: 200.28
MDL number: MFCD03839941
EINECS: 676-009-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB359.20 | In Stock |
|
| 100g | RMB1343.20 | In Stock |
|
| 500g | RMB5138.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-108°C |
| Boiling point: | 304.8±31.0 °C(Predicted) |
| Density | 1.02±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO, Methanol |
| pka | 12.37±0.20(Predicted) |
| form | Crystalline Powder |
| color | White |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-8-5-4-6-11-7-8/h8,11H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | WUOQXNWMYLFAHT-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1CCCNC1 |
| CAS DataBase Reference | 172603-05-3(CAS DataBase Reference) |
Description and Uses
N-3-Piperidinylcarbamic Acid 1,1-Dimethylethyl Ester is used in the synthesis of highly selective spleen tyrosine kinase inhibitors. Also used in the synthesis of a potent NHE1 inhibitor displaying cardioprotective effects.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H400 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53 |
| Safety Statements | 26-36/37/39-61-60 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
