A1354412
1-Boc-3-hydroxypiperidine , 98% , 85275-45-2
Synonym(s):
tert-Butyl 3-hydroxy-1-piperidinecarboxylate;1-Boc-3-piperidinol
CAS NO.:85275-45-2
Empirical Formula: C10H19NO3
Molecular Weight: 201.26
MDL number: MFCD02093938
EINECS: 628-428-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB104.00 | In Stock |
|
| 100G | RMB288.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-67°C |
| Boiling point: | 292.3±33.0 °C(Predicted) |
| Density | 1.107±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 14.74±0.20(Predicted) |
| color | White to Almost white |
| BRN | 4180859 |
| InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-6-4-5-8(12)7-11/h8,12H,4-7H2,1-3H3 |
| InChIKey | UIJXHKXIOCDSEB-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCC(O)C1 |
| CAS DataBase Reference | 85275-45-2(CAS DataBase Reference) |
Description and Uses
It is a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |






![tert-Butyl [4,4'-bipiperidine]-1-carboxylate](https://img.chemicalbook.com/CAS/GIF/171049-35-7.gif)
