A1355912
N-Boc-4-Hydroxypiperidine , 98% , 109384-19-2
Synonym(s):
tert-Butyl 4-hydroxy-1-piperidinecarboxylate;1-Boc-4-piperidinol
CAS NO.：109384-19-2
Empirical Formula: C10H19NO3
Molecular Weight: 201.26
MDL number: MFCD01075174
EINECS: 600-916-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB18.40 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB54.40 | In Stock |
|
| 100G | RMB131.20 | In Stock |
|
| 500G | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-65 °C (lit.) |
| Boiling point: | 292.3±33.0 °C(Predicted) |
| Density | 1.107±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Powder |
| pka | 14.80±0.20(Predicted) |
| color | White to cream |
| BRN | 7202094 |
| InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11/h8,12H,4-7H2,1-3H3 |
| InChIKey | PWQLFIKTGRINFF-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(O)CC1 |
| CAS DataBase Reference | 109384-19-2(CAS DataBase Reference) |
Description and Uses
Used in a synthesis of N-heterocyclic alkyl ethers via the Mitsunobu reaction.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
