A1356612
2-Bromo-4-methoxyphenylacetic acid , 97% , 66916-99-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB99.20 | In Stock |
|
| 5G | RMB345.60 | In Stock |
|
| 25G | RMB1060.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-131 °C (lit.) |
| Boiling point: | 353.6±27.0 °C(Predicted) |
| Density | 1.560±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| pka | 4.20±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C9H9BrO3/c1-13-7-3-2-6(4-9(11)12)8(10)5-7/h2-3,5H,4H2,1H3,(H,11,12) |
| InChIKey | XQELSBAAFMYSMG-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(OC)C=C1Br |
| CAS DataBase Reference | 66916-99-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H400 |
| Precautionary statements | P273-P301+P310+P330 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50 |
| Safety Statements | 60-61 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29189900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
