A1357112
N-Benzyl-L-prolinol , 97% , 53912-80-4
Synonym(s):
(S)-(−)-1-Benzylpyrrolidine-2-methanol
| Pack Size | Price | Stock | Quantity |
| 5G | RMB131.20 | In Stock |
|
| 25G | RMB431.20 | In Stock |
|
| 100G | RMB1564.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 115-120 °C/0.5 mmHg (lit.) |
| Density | 1.08 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | liquid |
| pka | 14.77±0.10(Predicted) |
| Appearance | Light yellow to yellow Liquid |
| optical activity | [α]20/D 72.7°, neat |
| BRN | 3663640 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C12H17NO/c14-10-12-7-4-8-13(12)9-11-5-2-1-3-6-11/h1-3,5-6,12,14H,4,7-10H2/t12-/m0/s1 |
| InChIKey | ZAIQBJPTOXDDKA-UHFFFAOYSA-N |
| SMILES | N1(CC2=CC=CC=C2)CCC[C@H]1CO |
Description and Uses
Precursor in the synthesis of proline-derived homochiral amine oxides. Starting material for enantiomerically pure 3-hydroxypiperidine, a structural feature present in many natural products.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10-34 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







