A1358012
(R)-1-Benzyl-3-(Boc-amino)pyrrolidine , 98% , 131878-23-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB58.40 | In Stock |
|
| 5G | RMB236.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-81 °C(lit.) |
| Boiling point: | 385.1±31.0 °C(Predicted) |
| Density | 1.08 |
| refractive index | 18.5 ° (C=2, EtOH) |
| storage temp. | 2-8°C |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 12.31±0.20(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D +6°, c = 1% in chloroform |
| InChI | 1S/C16H24N2O2/c1-16(2,3)20-15(19)17-14-9-10-18(12-14)11-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H,17,19)/t14-/m1/s1 |
| InChIKey | PHOIDJGLYWEUEK-CQSZACIVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(C1)Cc2ccccc2 |
| CAS DataBase Reference | 131878-23-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








![tert-Butyl[3-(Dimethylamino)propyl]carbamate](https://img.chemicalbook.com/CAS/GIF/216659-47-1.gif)