PRODUCT Properties
| Boiling point: | 77 °C/0.01 mmHg (lit.) |
| Density | 1.091 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | 5.56±0.20(Predicted) |
| form | Crystalline Powder, Crystals or Chunks |
| color | White to off-white |
| BRN | 1526217 |
| InChI | InChI=1S/C11H13NO/c13-11-6-7-12(9-11)8-10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | DHGMDHQNUNRMIN-UHFFFAOYSA-N |
| SMILES | N1(CC2=CC=CC=C2)CCC(=O)C1 |
| CAS DataBase Reference | 775-16-6(CAS DataBase Reference) |
Description and Uses
1-Benzyl-3-pyrrolidinone was used as starting reagent in the synthesis of vinyl triflate. It was used to prepare chiral, alkenyl sulfoximines leading to highly functionalized diazabicycles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338-P280a-P321-P332+P313-P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-24/25-36 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 29339900 |
