A1360850
PhenmediphaminMethanol , 1000μg/mlinMethanol , 13684-63-4
CAS NO.:13684-63-4
Empirical Formula: C16H16N2O4
Molecular Weight: 300.31
MDL number: MFCD00055419
EINECS: 237-199-0
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-144°C |
| Boiling point: | 441.54°C (rough estimate) |
| Density | 1.1782 (rough estimate) |
| refractive index | 1.6240 (estimate) |
| Flash point: | 100 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 13.03±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| Water Solubility | <0.1 g/100 mL at 21 ºC |
| BRN | 2395027 |
| Major Application | agriculture environmental |
| InChI | 1S/C16H16N2O4/c1-11-5-3-6-12(9-11)18-16(20)22-14-8-4-7-13(10-14)17-15(19)21-2/h3-10H,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | IDOWTHOLJBTAFI-UHFFFAOYSA-N |
| SMILES | COC(=O)Nc1cccc(OC(=O)Nc2cccc(C)c2)c1 |
| LogP | 3.590 |
| CAS DataBase Reference | 13684-63-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 3-m-tolylcarbamoyloxyphenylcarbamate(13684-63-4) |
| EPA Substance Registry System | Phenmedipham (13684-63-4) |
Description and Uses
Postemergence herbicide used to control weeds such as chickweed, dogfennel, foxtail, kochia, nightshade and yellow mustard, in strawberries, beet crops and spinach
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| RTECS | FD9050000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 13684-63-4(Hazardous Substances Data) |
| Toxicity | (96-hour) for bluegill sunfish 3.98 mg/L, rainbow trout 1.4–3.0 mg/L, Daphnia magna 3.2 mg/L (Worthing and Hance, 1991), harlequin fish 16.5 mg/L (Hartley and Kidd, 1987); acute oral LD50 of pure phenmedipham and the formulated product for rats 3,700 and 10,300 mg/kg, respectively (Ashton and Monaco, 1991). |




