A1361612
Benzophenone-3,3′,4,4′-tetracarboxylic dianhydride , 96%, sublimation and purification, low metal ions , 2421-28-5
Synonym(s):
4,4′-Carbonyldiphthalic anhydride
CAS NO.:2421-28-5
Empirical Formula: C17H6O7
Molecular Weight: 322.23
MDL number: MFCD00005923
EINECS: 219-348-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB151.20 | In Stock |
|
| 25G | RMB541.60 | In Stock |
|
| 100g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-222 °C (lit.) |
| Boiling point: | 320°C 5mm |
| Density | 1,57 g/cm3 |
| vapor density | 1.4 (vs air) |
| vapor pressure | <0.1 mm Hg ( 0 °C) |
| refractive index | 1.6380 (estimate) |
| Flash point: | 324 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 0.1 g/mL, clear |
| form | Needles or Crystalline Powder |
| color | Off-white to brown |
| explosive limit | 16% |
| Water Solubility | REACTS |
| Sensitive | Moisture Sensitive |
| λmax | 580nm(CH3CN)(lit.) |
| Sublimation | 220-230 ºC |
| BRN | 761777 |
| Stability: | Hygroscopic |
| InChI | 1S/C17H6O7/c18-13(7-1-3-9-11(5-7)16(21)23-14(9)19)8-2-4-10-12(6-8)17(22)24-15(10)20/h1-6H |
| InChIKey | VQVIHDPBMFABCQ-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2cc(ccc12)C(=O)c3ccc4C(=O)OC(=O)c4c3 |
| LogP | 3.3 at 25℃ |
| NIST Chemistry Reference | Bis-(3-phthalyl anhydride) ketone(2421-28-5) |
| EPA Substance Registry System | Benzophenonetetracarboxylic dianhydride (2421-28-5) |
Description and Uses
Used in the synthesis of polyimides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37 |
| Safety Statements | 25 |
| WGK Germany | 1 |
| F | 21 |
| Autoignition Temperature | 975 °F |
| TSCA | TSCA listed |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 STOT SE 3 |





