A1365912
6-Bromo-2-oxindole , 98% , 99365-40-9
CAS NO.:99365-40-9
Empirical Formula: C8H6BrNO
Molecular Weight: 212.04
MDL number: MFCD02179605
EINECS: 800-899-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB82.40 | In Stock |
|
| 25g | RMB301.60 | In Stock |
|
| 100g | RMB1195.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217-221 °C(lit.) |
| Boiling point: | 343.6±42.0 °C(Predicted) |
| Density | 1.666±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSo |
| pka | 13.39±0.20(Predicted) |
| form | Solid |
| color | Orange |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C8H6BrNO/c9-6-2-1-5-3-8(11)10-7(5)4-6/h1-2,4H,3H2,(H,10,11) |
| InChIKey | JARRYVQFBQVOBE-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(Br)=C2)CC1=O |
| CAS DataBase Reference | 99365-40-9(CAS DataBase Reference) |
Description and Uses
6-Bromo-2-Oxindole is an indolinone derivative used for the preparation of p38α inhibitors as potential antiinflammatories.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H312-H315-H319-H361-H371-H372-H373-H317-H341-H411 |
| Precautionary statements | P501-P273-P272-P260-P270-P202-P201-P264-P280-P391-P337+P313-P305+P351+P338-P308+P311-P362+P364-P333+P313-P301+P310+P330-P302+P352+P312-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |









![4-hydroxy-6-oxabicyclo[3.2.1]octan-7-one](https://img.chemicalbook.com/CAS/20200119/GIF/88255-83-8.gif)