A1366012
5-Bromo-2-hydroxy-3-nitropyridine , 98% , 15862-34-7
Synonym(s):
5-Bromo-3-nitro-2(1H)-pyridinone;5-Bromo-3-nitro-2-pyridinol
CAS NO.:15862-34-7
Empirical Formula: C5H3BrN2O3
Molecular Weight: 218.99
MDL number: MFCD00023473
EINECS: 239-989-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB48.80 | In Stock |
|
| 25G | RMB147.20 | In Stock |
|
| 100G | RMB546.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 246-250 °C |
| Boiling point: | 296.7±40.0 °C(Predicted) |
| Density | 1.98±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO, Methanol |
| pka | 6.31±0.10(Predicted) |
| form | Solid |
| color | Yellow |
| BRN | 383853 |
| InChI | InChI=1S/C5H3BrN2O3/c6-3-1-4(8(10)11)5(9)7-2-3/h1-2H,(H,7,9) |
| InChIKey | WXRLCVUDLFFTFF-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(Br)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 15862-34-7(CAS DataBase Reference) |
Description and Uses
5-Bromo-3-nitropyridin-2(1H)-one is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38-20 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








