A1370012
4-Bromo-1-methyl-1H-pyrazole , 98% , 15803-02-8
Synonym(s):
1-Methyl-4-bromopyrazole
CAS NO.:15803-02-8
Empirical Formula: C4H5BrN2
Molecular Weight: 161
MDL number: MFCD02179565
EINECS: 605-126-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB57.60 | In Stock |
|
| 100G | RMB176.00 | In Stock |
|
| 500g | RMB848.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 185-188°C |
| Density | 1.558 |
| refractive index | n20/D 1.531 |
| Flash point: | 93°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 0.21±0.10(Predicted) |
| color | Colorless to pale yellow |
| InChI | InChI=1S/C4H5BrN2/c1-7-3-4(5)2-6-7/h2-3H,1H3 |
| InChIKey | IXJSDKIJPVSPKF-UHFFFAOYSA-N |
| SMILES | N1(C)C=C(Br)C=N1 |
| CAS DataBase Reference | 15803-02-8(CAS DataBase Reference) |
Description and Uses
4-Bromo-1-methylpyrazole is a colourless or light yellow liquid at room temperature and pressure. It can be used as an intermediate in organic synthesis. It has good solubility in common organic solvents such as ethyl acetate, dichloromethane, dimethyl sulfoxide, and N, N-dimethylformamide but poor solubility in water.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | UN1760 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








