A1371412
2-Bromo-5-fluorobenzyl alcohol , 97% , 202865-66-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB60.00 | In Stock |
|
| 25g | RMB236.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 91-94 °C |
| Boiling point: | 252.5±25.0 °C(Predicted) |
| Density | 1.658±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.67±0.10(Predicted) |
| form | Solid |
| color | Yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H6BrFO/c8-7-2-1-6(9)3-5(7)4-10/h1-3,10H,4H2 |
| InChIKey | HXGZPMHPSBJMKB-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC(F)=CC=C1Br |
| CAS DataBase Reference | 202865-66-5(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-fluorobenzyl alcohol is used as intermediates in pharmaceutical and organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H302-H319 |
| Precautionary statements | P261-P280a-P304+P340-P405-P501a-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2906290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |




