A1371912
1-Bromo-2,3,5-trifluorobenzene , 98% , 133739-70-5
CAS NO.：133739-70-5
Empirical Formula: C6H2BrF3
Molecular Weight: 210.98
MDL number: MFCD00012232
EINECS: 623-354-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB64.00 | In Stock |
|
| 5G | RMB236.80 | In Stock |
|
| 25g | RMB920.00 | In Stock |
|
| 100g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 143℃ |
| Density | 1.758 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 89 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.758 |
| color | Colorless to yellow |
| BRN | 7369071 |
| InChI | InChI=1S/C6H2BrF3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
| InChIKey | XSMLLZPSNLQCQU-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=CC(F)=C1F |
| CAS DataBase Reference | 133739-70-5(CAS DataBase Reference) |
Description and Uses
1-Bromo-2,3,5-trifluorobenzene is mainly used in organic synthesis.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P303+P361+P353-P405-P501a-P210-P233-P240-P241+P242+P243-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2903998090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
