PRODUCT Properties
| Melting point: | 168 °C (dec.)(lit.) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| form | powder to crystal |
| pka | 11.69±0.46(Predicted) |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C6H12N2O4/c9-3-1-7-5(11)6(12)8-2-4-10/h9-10H,1-4H2,(H,7,11)(H,8,12) |
| InChIKey | FPQJEXTVQZHURJ-UHFFFAOYSA-N |
| SMILES | C(NCCO)(=O)C(NCCO)=O |
| CAS DataBase Reference | 1871-89-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Oxamide, n,n'-bis-(2-hydroxyethyl)-(1871-89-2) |
| EPA Substance Registry System | Ethanediamide, N1,N2-bis(2-hydroxyethyl)- (1871-89-2) |
Description and Uses
N.N'-Bis(2-hydroxyethyl)oxamide is an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | T,Xi |
| Risk Statements | 43 |
| Safety Statements | 45-36/37 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2924.19.8000 |
| HazardClass | 8 |
| PackingGroup | III |
