A1372412
2-Bromopyridine-4-carboxylic acid , 98% , 66572-56-3
Synonym(s):
2-Bromoisonicotinic acid
CAS NO.:66572-56-3
Empirical Formula: C6H4BrNO2
Molecular Weight: 202.01
MDL number: MFCD01646069
EINECS: 626-472-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB1284.00 | In Stock |
|
| 25G | RMB4479.20 | In Stock |
|
| 100G | RMB12543.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-231°C |
| Boiling point: | 447.2±30.0 °C(Predicted) |
| Density | 1.813±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 2.98±0.10(Predicted) |
| form | Crystals or Crystalline Powder |
| color | White |
| BRN | 471895 |
| InChI | InChI=1S/C6H4BrNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3H,(H,9,10) |
| InChIKey | YBTKGKVQEXAYEM-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 66572-56-3(CAS DataBase Reference) |
Description and Uses
2-Bromoisonicotinic acid (CAS 66572-56-3) is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





