5-Bromouridine , 99% , 957-75-5
Synonym(s):
5-Bromouracil-1-β-D -ribofuranoside
CAS NO.:957-75-5
Empirical Formula: C9H11BrN2O6
Molecular Weight: 323.1
MDL number: MFCD00006528
EINECS: 213-486-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB44.00 | In Stock |
|
| 1G | RMB120.80 | In Stock |
|
| 5g | RMB408.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 180-182 °C (dec.) (lit.) |
| alpha | -11 º (c=2 in H2O) |
| Density | 1.9322 (rough estimate) |
| refractive index | 1.6520 (estimate) |
| storage temp. | -20°C |
| solubility | Water (Sonicated) |
| pka | 7.73±0.10(Predicted) |
| form | Solid |
| color | Off-White |
| optical activity | [α]22/D 11°, c = 2 in H2O |
| Water Solubility | Insoluble in water. |
| BRN | 33664 |
| InChI | 1S/C9H11BrN2O6/c10-3-1-12(9(17)11-7(3)16)8-6(15)5(14)4(2-13)18-8/h1,4-6,8,13-15H,2H2,(H,11,16,17)/t4-,5-,6-,8-/m1/s1 |
| InChIKey | AGFIRQJZCNVMCW-UAKXSSHOSA-N |
| SMILES | OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N2C=C(Br)C(=O)NC2=O |
| CAS DataBase Reference | 957-75-5(CAS DataBase Reference) |
Description and Uses
5-Bromouridine is an energy-related metabolite that is a precursor of uridine. 5-Bromouridine binds to the nuclear DNA in cells, where it can act as a transcriptional regulator. 5-Bromouridine is used in the treatment of malignant brain tumors, where it can inhibit tumor growth by binding to the dna of cancer cells and preventing the synthesis of proteins required for cell division.
5-Bromouridine is often incorporated into RNA in order to detect immunocytochemically and analyzed by cytometry. It possesses anti-viral activity and inhibits the activity of viruses such as human immunodeficiency virus.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210-P403+P235 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | YU7300000 |
| F | 10 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |





