A1376912
2-Bromo-5-iodopyridine , 97% , 73290-22-9
CAS NO.：73290-22-9
Empirical Formula: C5H3BrIN
Molecular Weight: 283.89
MDL number: MFCD03095201
EINECS: 629-182-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB242.40 | In Stock |
|
| 100g | RMB935.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-123 °C (lit.) |
| Boiling point: | 278.6±20.0 °C(Predicted) |
| Density | 2.347±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -1.23±0.10(Predicted) |
| form | Powder |
| color | White to off-white |
| Sensitive | Light Sensitive |
| BRN | 109100 |
| InChI | InChI=1S/C5H3BrIN/c6-5-2-1-4(7)3-8-5/h1-3H |
| InChIKey | LLKRSJVPTKFSLS-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(I)C=C1 |
| CAS DataBase Reference | 73290-22-9(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-iodopyridine can be used to develop fluorescent compounds (manisyl-substituted terpyridine, bipyridine, and phenanthroline). It is also a useful reagent for investigating the structure/activity relationships of non-nucleoside adenosine kinase inhibitors.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
