A1377512
5-Bromoindole-3-carboxaldehyde , 98% , 877-03-2
CAS NO.:877-03-2
Empirical Formula: C9H6BrNO
Molecular Weight: 224.05
MDL number: MFCD00152016
EINECS: 212-884-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB108.00 | In Stock |
|
| 25G | RMB400.00 | In Stock |
|
| 100g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-207 °C (lit.) |
| Boiling point: | 395.6±22.0 °C(Predicted) |
| Density | 1.727±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 14.54±0.30(Predicted) |
| form | Crystalline Powder |
| color | Beige to brown |
| BRN | 124725 |
| InChI | InChI=1S/C9H6BrNO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H |
| InChIKey | PEENKJZANBYXNB-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C(C=O)=C1 |
| CAS DataBase Reference | 877-03-2(CAS DataBase Reference) |
Description and Uses
5-Bromoindole-3-carboxaldehyde serves as a precursor for synthesizing substituted indole derivatives via N-alkylation with 1-bromohexane or 1-bromooctane in the presence of potassium carbonate[1]. The compound inhibits quorum-sensing-dependent virulence factors in Pseudomonas aeruginosa strains Pa01, Pa14, and ATCC 27853[2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







