A1379212
3-(2-Bromophenyl)propionic acid , 97% , 15115-58-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB260.80 | In Stock |
|
| 100G | RMB607.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-102 °C (lit.) |
| Boiling point: | 186°C/15mmHg(lit.) |
| Density | 1.531±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.60±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C9H9BrO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12) |
| InChIKey | AOACQJFIGWNQBC-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=CC=C1Br |
| CAS DataBase Reference | 15115-58-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3261 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
