A1381812
5-Bromo-4-chloro-3-indolyl acetate , 99%, ester enzyme substrate , 3252-36-6
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB148.00 | In Stock |
|
| 100MG | RMB639.20 | In Stock |
|
| 200mg | RMB1039.20 | In Stock |
|
| 500MG | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106-107℃ |
| Boiling point: | 429℃ |
| Density | 1.721 |
| Flash point: | 213℃ |
| storage temp. | -20°C |
| solubility | ethanol: 50mg/mL, clear, colorless to faintly yellow |
| form | powder to crystal |
| pka | 14.03±0.30(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C10H7BrClNO2/c1-5(14)15-8-4-13-7-3-2-6(11)10(12)9(7)8/h2-4,13H,1H3 |
| InChIKey | WPWLFFMSSOAORQ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(Cl)=C(Br)C=C2)C(OC(=O)C)=C1 |
Description and Uses
A histochemical substrate for esterase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29339900 |






