A1382212
2-Bromo-4′-cyanoacetophenone , >96.0%(GC) , 20099-89-2
CAS NO.:20099-89-2
Empirical Formula: C9H6BrNO
Molecular Weight: 224.05
MDL number: MFCD00052931
EINECS: 606-435-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB56.80 | In Stock |
|
| 5G | RMB152.00 | In Stock |
|
| 25G | RMB588.00 | In Stock |
|
| 100G | RMB2040.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-96 °C(lit.) |
| Boiling point: | 342.4±22.0 °C(Predicted) |
| Density | 1.56±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Off-white to light yellow |
| BRN | 2087648 |
| InChI | InChI=1S/C9H6BrNO/c10-5-9(12)8-3-1-7(6-11)2-4-8/h1-4H,5H2 |
| InChIKey | LJANCPRIUMHGJE-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C(CBr)=O)C=C1 |
| CAS DataBase Reference | 20099-89-2(CAS DataBase Reference) |
Description and Uses
2-Bromo-4′-cyanoacetophenone may be used to synthesize:
- 3-acylindolizines
- (2R,3R)-3-[4-(4-cyanophenyl)thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-2-butanol
- 1-[2-(4-cyanophenyl)-2-oxoethyl]-1,10-phenanthrolinium bromide
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H314 |
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 2928 6.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29269090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |






