PRODUCT Properties
| Melting point: | 70-74 °C(lit.) |
| Boiling point: | 327.8±22.0 °C(Predicted) |
| Density | 1.622±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Dichloromethane, Ethyl Acetate, Methanol |
| form | powder |
| pka | 8.97±0.10(Predicted) |
| color | Fawn to brown |
| InChI | InChI=1S/C8H7BrO2/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4,10H,5H2 |
| InChIKey | IEPSGFQQGKPTPM-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC(O)=C1)CBr |
Description and Uses
Reactant involved in the synthesis of:
- Pyrrole-3-carboxylic acids
- N-aryl-N-thiazolyl compounds via the Hantzsch reaction
- Disubstituted oxadiazolylindole derivatives with antiinflammatory, analgesic and nitric oxide releasing activity
- Anilino-aryl-thiazoles with inhibitory activity toward valosin-containing proteins
- Tyrosine kinase erythropoietin inhibitors
- E. coli methionine aminopeptidase inhibitors
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314-H317 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 22-34-43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3263 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29147000 |
