A1383012
1-Boc-3-aminoazetidine , 94% , 193269-78-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB35.20 | In Stock |
|
| 1G | RMB43.20 | In Stock |
|
| 5g | RMB157.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 79-81 3mm |
| Density | 1.1g/ml |
| refractive index | 1.4650 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO, Methanol, Water |
| form | Oil |
| pka | 8.29±0.20(Predicted) |
| color | Clear Colourless to Pale Yellow |
| InChI | InChI=1S/C8H16N2O2/c1-8(2,3)12-7(11)10-4-6(9)5-10/h6H,4-5,9H2,1-3H3 |
| InChIKey | WPGLRFGDZJSQGI-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC(N)C1 |
| CAS DataBase Reference | 193269-78-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Warning |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 34-51-22 |
| Safety Statements | 26-36-45-36/37/39 |
| RIDADR | 2735 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
