A1386812
5-Bromo-2-thiophenecarboxylic acid , 98% , 7311-63-9
CAS NO.:7311-63-9
Empirical Formula: C5H3BrO2S
Molecular Weight: 207.05
MDL number: MFCD00079725
EINECS: 615-911-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB51.20 | In Stock |
|
| 25G | RMB192.00 | In Stock |
|
| 100g | RMB674.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140 °C |
| Boiling point: | 318.9±27.0 °C(Predicted) |
| Density | 1.923±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.32±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to cream |
| BRN | 118364 |
| InChI | InChI=1S/C5H3BrO2S/c6-4-2-1-3(9-4)5(7)8/h1-2H,(H,7,8) |
| InChIKey | COWZPSUDTMGBAT-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC(Br)=CC=1 |
| CAS DataBase Reference | 7311-63-9(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-thiophenecarboxylic acid may be used in the preparation of:
- 5-bromo-2-thiophenecarboxylic acid butyl ester
- sulphonyl-tetrafluorophenyl (STP) esters
- new porphyrin sensitizers based on donor-Π-acceptor (D-Π-A) approach
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-22-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![7-Bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/879896-63-6.gif)
