A1387612
9-Bromononanoic Acid , 97%(T) , 41059-02-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.00 | In Stock |
|
| 500MG | RMB46.40 | In Stock |
|
| 1G | RMB90.40 | In Stock |
|
| 5G | RMB357.60 | In Stock |
|
| 25g | RMB1420.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39°C |
| Boiling point: | 165°C/3mm |
| Density | 1.282±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Soluble), DMSO (Slightly) |
| form | Solid |
| pka | 4.78±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C9H17BrO2/c10-8-6-4-2-1-3-5-7-9(11)12/h1-8H2,(H,11,12) |
| InChIKey | XEGRKZRPTBNSMN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCCCBr |
| CAS DataBase Reference | 41059-02-3(CAS DataBase Reference) |
Description and Uses
9-Bromononanoic Acid is an intermediate in synthesizing Rumenic Acid (R701590), a trans fatty acid that may potentially reduce the risk of cancer and cardiovascular diseases. It may also prevent disease processes that lead to chronic inflammation, atherosclerosis, and diabetes.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| Hazard Codes | Xi |
| Risk Statements | 34 |
| Safety Statements | 36/37/39 |
| RIDADR | 3261 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2916399090 |
