A1388012
4-Bromoquinoline , 95% , 3964-04-3
CAS NO.:3964-04-3
Empirical Formula: C9H6BrN
Molecular Weight: 208.05
MDL number: MFCD07644514
EINECS: 625-847-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB127.20 | In Stock |
|
| 25g | RMB511.20 | In Stock |
|
| 100g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 29-34 °C |
| Boiling point: | 270 C |
| Density | 1.564±0.06 g/cm3(Predicted) |
| Flash point: | >110℃ |
| storage temp. | 2-8°C |
| form | solid |
| pka | 3.39±0.13(Predicted) |
| color | Light brown |
| InChI | InChI=1S/C9H6BrN/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H |
| InChIKey | SUXIPCHEUMEUSV-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(Br)=CC=1 |
| CAS DataBase Reference | 3964-04-3(CAS DataBase Reference) |
Description and Uses
4-Bromoquinoline is used to prepare bone morphogenetic protein (BMP) signaling inhibitors. It is also used to synthesize novel azalides derived from 16-membered macrolides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





