A1388612
5-Bromo-8-nitroisoquinoline , 97% , 63927-23-1
CAS NO.：63927-23-1
Empirical Formula: C9H5BrN2O2
Molecular Weight: 253.05
MDL number: MFCD02091227
EINECS: 804-292-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB165.60 | In Stock |
|
| 25g | RMB613.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-140 °C |
| Boiling point: | 386.9±27.0 °C(Predicted) |
| Density | 1.747±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2?+-.0.36(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | 1S/C9H5BrN2O2/c10-8-1-2-9(12(13)14)7-5-11-4-3-6(7)8/h1-5H |
| InChIKey | ULGOLOXWHJEZNZ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Br)c2ccncc12 |
| CAS DataBase Reference | 63927-23-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | T |
| Risk Statements | 25-37/38-41 |
| Safety Statements | 26-39-45 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 |
