A1392712
4-Bromo-3-fluorobenzoic acid , 98% , 153556-42-4
CAS NO.:153556-42-4
Empirical Formula: C7H4BrFO2
Molecular Weight: 219.01
MDL number: MFCD00672932
EINECS: 630-193-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB52.00 | In Stock |
|
| 25G | RMB179.20 | In Stock |
|
| 100G | RMB423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 207 °C |
| Boiling point: | 296.1±25.0 °C(Predicted) |
| Density | 1.789±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| pka | 3.63±0.10(Predicted) |
| color | Off white to cream |
| InChI | InChI=1S/C7H4BrFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) |
| InChIKey | RMYOGXPGIDWJLU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C(F)=C1 |
| CAS DataBase Reference | 153556-42-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-bromo-3-fluoro- (153556-42-4) |
Description and Uses
4-Bromo-3-fluorobenzoic acid is an important chemical raw material and can be used to prepare a variety of drugs (such as the anticancer drug benzamide).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |





