A1393212
N-Boc-cis-4-hydroxy-D-proline methyl ester , 95% , 114676-69-6
CAS NO.：114676-69-6
Empirical Formula: C11H19NO5
Molecular Weight: 245.27
MDL number: MFCD00797548
EINECS: 675-952-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 250MG | RMB23.20 | In Stock |
|
| 5G | RMB78.40 | In Stock |
|
| 25G | RMB242.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76 °C |
| Boiling point: | 335.2±42.0 °C(Predicted) |
| alpha | 63° (C=1,EtOH) |
| Density | 1.216±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| pka | 14.27±0.40(Predicted) |
| form | Powder |
| color | White |
| InChI | InChI=1S/C11H19NO5/c1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h7-8,13H,5-6H2,1-4H3/t7-,8-/m1/s1 |
| InChIKey | MZMNEDXVUJLQAF-HTQZYQBOSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@H](O)C[C@@H]1C(OC)=O |
Description and Uses
(2R,4R)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate (N-Boc-cis-4-hydroxy-D-proline methyl ester) is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). (2R,4R)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2933998090 |
