A1393812
4-Bromo-2,3-difluorophenol , 98% , 144292-32-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB125.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53.0 to 57.0 °C |
| Boiling point: | 213.3±35.0 °C(Predicted) |
| Density | 1.858±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 7.16±0.23(Predicted) |
| color | White to Gray to Brown |
| InChI | InChI=1S/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
| InChIKey | JZAVCMMYGSROJP-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C(F)=C1F |
| CAS DataBase Reference | 144292-32-0(CAS DataBase Reference) |
Description and Uses
4-Bromo-2,3-difluorophenol is used as medical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H301-H335 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501-P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | 2811 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2908190090 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |







