A1396312
2-Bromo-4-pyridinemethanol , 96% , 118289-16-0
Synonym(s):
2-Bromopyridine-4-methanol
CAS NO.:118289-16-0
Empirical Formula: C6H6BrNO
Molecular Weight: 188.02
MDL number: MFCD04039313
EINECS: 663-333-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB134.40 | In Stock |
|
| 25g | RMB599.20 | In Stock |
|
| 100g | RMB2199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-61°C |
| Boiling point: | 316.6±27.0 °C(Predicted) |
| Density | 1.668±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | 13.06±0.10(Predicted) |
| color | White |
| BRN | 4244047 |
| InChI | InChI=1S/C6H6BrNO/c7-6-3-5(4-9)1-2-8-6/h1-3,9H,4H2 |
| InChIKey | IQNUGAFIKDRYRP-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(CO)=C1 |
| CAS DataBase Reference | 118289-16-0(CAS DataBase Reference) |
Description and Uses
2-Bromo-4-hydroxymethylpyridine is used to synthesize aza- and diazabiphenyl analogs of the antitubercular drug (6S)-2-nitro-6-{[4-(trifluoromethoxy)benzyl]oxy}-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PA-824). It is also used to N3/8-disubstituted 3,8-diazabicyclo[3.2.1]octane analogues of 3,8-bis[2-(3,4,5-trimethoxyphenyl)pyridin-4-yl]methyl-piperazine with antiproliferative properties.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37-22 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |






