A1396812
5-Bromopyridine-3-carboxylic acid , 99% , 20826-04-4
Synonym(s):
5-Bromonicotinic acid;5-Bromopyridine-3-carboxylic acid
CAS NO.：20826-04-4
Empirical Formula: C6H4BrNO2
Molecular Weight: 202.01
MDL number: MFCD00009783
EINECS: 244-065-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB41.60 | In Stock |
|
| 100G | RMB112.00 | In Stock |
|
| 500G | RMB503.20 | In Stock |
|
| 1KG | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-180 °C(lit.) |
| Boiling point: | 259.67°C (rough estimate) |
| Density | 1.7477 (rough estimate) |
| vapor pressure | 0.01Pa at 25℃ |
| refractive index | 1.6120 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.08±0.10(Predicted) |
| form | Powder |
| color | White to yellow-gray or light brown |
| BRN | 115854 |
| InChI | InChI=1S/C6H4BrNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10) |
| InChIKey | FQIUCPGDKPXSLL-UHFFFAOYSA-N |
| SMILES | C1=NC=C(Br)C=C1C(O)=O |
| LogP | 1.17-1.29 at 23.5℃ and pH6.4 |
| CAS DataBase Reference | 20826-04-4(CAS DataBase Reference) |
Description and Uses
5-Bromopyridine-3-carboxylic acid (5-bromonicotinic acid) was used in the synthesis of 3-guanidinomethyl-5-iodopyridine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P305+P351+P338-P261-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | QT0868000 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
