A1397412
3-Bromobenzotrifluoride , 98% , 401-78-5
Synonym(s):
1-Bromo-3-(trifluoromethyl)benzene;3-Bromo-α,α,α-trifluorotoluene
CAS NO.:401-78-5
Empirical Formula: C7H4BrF3
Molecular Weight: 225.01
MDL number: MFCD00000380
EINECS: 206-932-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB52.00 | In Stock |
|
| 100G | RMB137.60 | In Stock |
|
| 500G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 1°C |
| Boiling point: | 151-152 °C(lit.) |
| Density | 1.613 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 110 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Specific Gravity | 1.613 |
| BRN | 1449557 |
| InChI | InChI=1S/C7H4BrF3/c8-6-3-1-2-5(4-6)7(9,10)11/h1-4H |
| InChIKey | NNMBNYHMJRJUBC-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 401-78-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-3-(trifluoromethyl)-(401-78-5) |
| EPA Substance Registry System | 3-Bromobenzotrifluoride (401-78-5) |
Description and Uses
1-Bromo-3-(trifluoromethyl)benzene is used in the synthesis of calcium channel inhibitors for inflammatory and neuropathic pain.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 23-24/25-37/39-26-16-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | XS7970000 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29036990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





