A1398112
2-Bromo-5-(trifluoromethyl)pyridine , 97% , 50488-42-1
CAS NO.:50488-42-1
Empirical Formula: C6H3BrF3N
Molecular Weight: 225.99
MDL number: MFCD00153086
EINECS: 628-661-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100G | RMB423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-48 °C |
| Boiling point: | 78 °C |
| Density | 1.707±0.06 g/cm3(Predicted) |
| Flash point: | 78-81°C/30mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol and ethanol. |
| form | Crystalline |
| pka | -1+-.0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C6H3BrF3N/c7-5-2-1-4(3-11-5)6(8,9)10/h1-3H |
| InChIKey | GSKMWMFOQQBVMI-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 50488-42-1(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-(trifluoromethyl)pyridine is substrate used in a palladium-catalyzed α-arylation of a Refomatsky reagent.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 25-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-22-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





