A1398212
4-Bromo-3-fluoroaniline , 98% , 656-65-5
CAS NO.:656-65-5
Empirical Formula: C6H5BrFN
Molecular Weight: 190.01
MDL number: MFCD00672933
EINECS: 628-120-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 10G | RMB47.20 | In Stock |
|
| 25G | RMB98.40 | In Stock |
|
| 100G | RMB389.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-73°C |
| Boiling point: | 65-68 °C (lit.) |
| Density | 0.982 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 105 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetonitrile, Methanol |
| form | Crystalline Powder |
| pka | 2.88±0.10(Predicted) |
| color | Yellow to tan |
| Water Solubility | Soluble in acetonitrile, methanol. Insoluble in water. |
| BRN | 3236457 |
| InChI | InChI=1S/C6H5BrFN/c7-5-2-1-4(9)3-6(5)8/h1-3H,9H2 |
| InChIKey | YTMVYYAKOPIJCZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C(F)=C1 |
| CAS DataBase Reference | 656-65-5(CAS DataBase Reference) |
Description and Uses
4-Bromo-3-fluoroaniline is a intermediate used for the synthetic preparation of Tradizolid and various pharmaceuticals such as the synthesis of several lateral difluoro-substituted 4,4"-dialkyl- and 4 ,4"-alkoxyalkylterphenyls.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







