A1400812
1-Butyl-2-pyrrolidone , >98.0%(GC) , 3470-98-2
CAS NO.:3470-98-2
Empirical Formula: C8H15NO
Molecular Weight: 141.21
MDL number: MFCD00020876
EINECS: 222-437-8
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB132.80 | In Stock |
|
| 25ML | RMB434.40 | In Stock |
|
| 100ML | RMB1574.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 137 °C / 28mmHg |
| Density | 0,96 g/cm3 |
| vapor pressure | 13Pa at 25℃ |
| refractive index | 1.4640 to 1.4660 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly) |
| pka | -0.41±0.20(Predicted) |
| form | Oil |
| color | Colourless |
| Water Solubility | 1000g/L at 20℃ |
| InChI | InChI=1S/C8H15NO/c1-2-3-6-9-7-4-5-8(9)10/h2-7H2,1H3 |
| InChIKey | BNXZHVUCNYMNOS-UHFFFAOYSA-N |
| SMILES | N1(CCCC)CCCC1=O |
| LogP | 1.265 at 20℃ |
| CAS DataBase Reference | 3470-98-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Pyrrolidinone, 1-butyl-(3470-98-2) |
| EPA Substance Registry System | 2-Pyrrolidinone, 1-butyl- (3470-98-2) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 23-24/25 |
| RTECS | UY5746000 |
| TSCA | TSCA listed |
| HS Code | 2933790030 |
| Toxicity | mouse,LD50,intraperitoneal,500mg/kg (500mg/kg),BEHAVIORAL: ANTIPSYCHOTICBEHAVIORAL: ATAXIA,Journal of Pharmaceutical Sciences. Vol. 60, Pg. 1058, 1971. |




