A1401112
Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) , >96.0% , 31277-98-2
Synonym(s):
Bis(DIPHOS)palladium(0);Pd(DIPHOS)2;Pd(dppe)2
CAS NO.:31277-98-2
Empirical Formula: C52H48P4Pd
Molecular Weight: 903.25
MDL number: MFCD00009880
EINECS: 625-554-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB100.80 | In Stock |
|
| 1G | RMB248.80 | In Stock |
|
| 5G | RMB1134.40 | In Stock |
|
| 25G | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 219-225 °C |
| storage temp. | -20°C |
| solubility | sol nonprotic solvents |
| form | Powder |
| color | orange |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/2C26H24P2.Pd/c2*1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;/h2*1-20H,21-22H2; |
| InChIKey | UTBLWXFSGOYWOH-UHFFFAOYSA-R |
| SMILES | P(CCP(C1=CC=CC=C1)C1=CC=CC=C1)(C1C=CC=CC=1)C1=CC=CC=C1.P(CCP(C1=CC=CC=C1)C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1.[Pd] |
| CAS DataBase Reference | 31277-98-2 |
Description and Uses
Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) is a homogeneous catalyst most widely used in allylic substitution reactions; good catalyst for bulky substrates; slowly dissociating ligand that gives good stereoselectivity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36-37/39-26 |
| RIDADR | 1479 |
| WGK Germany | 3 |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 28439000 |

![Bis[1,2-bis(diphenylphosphino)ethane]palladium(0)](https://img.chemicalbook.com/CAS/GIF/31277-98-2.gif)



