A1402112
Benzyltrimethylammonium hydroxide solution , 40wt.%inH2O , 100-85-6
CAS NO.:100-85-6
Empirical Formula: C10H17NO
Molecular Weight: 167.25
MDL number: MFCD00008281
EINECS: 202-895-5
| Pack Size | Price | Stock | Quantity |
| 25ml | RMB44.80 | In Stock |
|
| 100ML | RMB126.40 | In Stock |
|
| 500ML | RMB503.20 | In Stock |
|
| 2.5L | RMB1955.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80 °C |
| Boiling point: | 65°C |
| Density | 1.059 g/mL at 25 °C |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n |
| Flash point: | 60 °F |
| storage temp. | Store below +30°C. |
| solubility | Miscible with alcohols, hydrocarbons, aromatic hydrocarbons and halogenated solvents. |
| form | Solution |
| color | Clear slightly yellow |
| PH | 12 (20°C in H2O, undiluted) |
| explosive limit | 5.50-36.50% |
| Water Solubility | Miscible with water, hydrocarbons, aromatic hydrocarbons and halogenated solvents. |
| Sensitive | Air Sensitive |
| BRN | 3917256 |
| Exposure limits | ACGIH: TWA 200 ppm; STEL 250 ppm (Skin) OSHA: TWA 200 ppm(260 mg/m3) NIOSH: IDLH 6000 ppm; TWA 200 ppm(260 mg/m3); STEL 250 ppm(325 mg/m3) |
| InChI | 1S/C10H16N.H2O/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H2/q+1;/p-1 |
| InChIKey | NDKBVBUGCNGSJJ-UHFFFAOYSA-M |
| SMILES | [OH-].C[N+](C)(C)Cc1ccccc1 |
| LogP | -3 at 20℃ |
| CAS DataBase Reference | 100-85-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzyltrimethylammonium hydroxide (100-85-6) |
Description and Uses
Benzyltrimethylammonium hydroxide can be used:
- As a base in the synthesis of activated ynesulfonamides and tertiary enesulfonamides.
- In the synthesis of 3-indolyl-3-hydroxy oxindoles by treating isatin with indole.
- As a precursor for the preparation of quaternary ammonium acetate, benzyltrimethylammonium acetate (NBz111AcO). NBz111AcO solution in DMSO can be used to dissolve cellulose.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H314-H370 |
| Precautionary statements | P210-P233-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,T,F |
| Risk Statements | 34-39/23/24/25-23/24/25-11 |
| Safety Statements | 26-36/37/39-45-46-16-28A-7 |
| RIDADR | UN 3267 8/PG 2 |
| WGK Germany | 1 |
| RTECS | BO8575000 |
| F | 9-23 |
| Autoignition Temperature | 455°C |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29239000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1A |
| Toxicity | LDLo scu-mus: 35 mg/kg JPETAB 28,367,26 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







