PRODUCT Properties
| Melting point: | 138-145℃ |
| Boiling point: | 370.1±37.0 °C(Predicted) |
| Density | 1.818±0.06 g/cm3(Predicted) |
| RTECS | US4000000 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Solid |
| pka | 7.02±0.24(Predicted) |
| color | White to off-white to yellow |
| Sensitive | Moisture & Light Sensitive |
| InChI | InChI=1S/C5H6BrN3/c6-3-1-9-2-4(7)5(3)8/h1-2H,7H2,(H2,8,9) |
| InChIKey | CMFSWSZEHYPECE-UHFFFAOYSA-N |
| SMILES | C1=NC=C(Br)C(N)=C1N |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN2811 |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
| Toxicity | mouse,LD50,intraperitoneal,100mg/kg (100mg/kg),Journal of Medicinal Chemistry. Vol. 8, Pg. 296, 1965. |







![7-Bromo-1,3-dihydroimidazo[4,5-c]pyridin-2-one](https://img.chemicalbook.com/CAS/GIF/161836-12-0.gif)